About 2,2-bis(2,3-dichlorophenyl)propanediamide
2,2-bis(2,3-dichlorophenyl)propanediamide (PubChem CID 69106750) has the molecular formula C15H10Cl4N2O2
and a molecular weight of 392.07 g/mol. Its IUPAC name is 2,2-bis(2,3-dichlorophenyl)propanediamide.
Molecular Properties
| Compound Name | 2,2-bis(2,3-dichlorophenyl)propanediamide |
| PubChem CID | 69106750 |
| Molecular Formula | C15H10Cl4N2O2 |
| Molecular Weight | 392.07 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | 2,2-bis(2,3-dichlorophenyl)propanediamide |
| SMILES | NC(=O)C(C(N)=O)(c1cccc(Cl)c1Cl)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H10Cl4N2O2/c16-9-5-1-3-7(11(9)18)15(13(20)22,14(21)23)8-4-2-6-10(17)12(8)19/h1-6H,(H2,20,22)(H2,21,23) |
| InChIKey | NTABYMFANKANLW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.07 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(2,3-dichlorophenyl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(2,3-dichlorophenyl)propanediamide?
The IUPAC name of 2,2-bis(2,3-dichlorophenyl)propanediamide (CID 69106750) is 2,2-bis(2,3-dichlorophenyl)propanediamide.
What is the SMILES notation for 2,2-bis(2,3-dichlorophenyl)propanediamide?
The canonical SMILES for 2,2-bis(2,3-dichlorophenyl)propanediamide is NC(=O)C(C(N)=O)(c1cccc(Cl)c1Cl)c1cccc(Cl)c1Cl.
What is the InChIKey of 2,2-bis(2,3-dichlorophenyl)propanediamide?
The InChIKey is NTABYMFANKANLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl4N2O2/c16-9-5-1-3-7(11(9)18)15(13(20)22,14(21)23)8-4-2-6-10(17)12(8)19/h1-6H,(H2,20,22)(H2,21,23).
What are the key properties of 2,2-bis(2,3-dichlorophenyl)propanediamide?
2,2-bis(2,3-dichlorophenyl)propanediamide has a molecular weight of 392.07 g/mol, XLogP of 3.56, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2,3-dichlorophenyl)propanediamide is sourced from PubChem (CID 69106750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).