C31H46Cl2N2O2Ti — CID 159653137
2,2-bis(2,6-ditert-butylphenyl)propanediamide;dichlorotitanium (PubChem CID 159653137) has the molecular formula C31H46Cl2N2O2Ti and a molecular weight of 597.49 g/mol. Its IUPAC name is 2,2-bis(2,6-ditert-butylphenyl)propanediamide;dichlorotitanium.
| Compound Name | 2,2-bis(2,6-ditert-butylphenyl)propanediamide;dichlorotitanium |
|---|---|
| PubChem CID | 159653137 |
| Molecular Formula | C31H46Cl2N2O2Ti |
| Molecular Weight | 597.49 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | 2,2-bis(2,6-ditert-butylphenyl)propanediamide;dichlorotitanium |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1C(C(N)=O)(C(N)=O)c1c(C(C)(C)C)cccc1C(C)(C)C.Cl[Ti]Cl |
| InChI | InChI=1S/C31H46N2O2.2ClH.Ti/c1-27(2,3)19-15-13-16-20(28(4,5)6)23(19)31(25(32)34,26(33)35)24-21(29(7,8)9)17-14-18-22(24)30(10,11)12;;;/h13-18H,1-12H3,(H2,32,34)(H2,33,35);2*1H;/q;;;+2/p-2 |
| InChIKey | MRVGHSHPQUGUFS-UHFFFAOYSA-L |
| XLogP | 7.51 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.49 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|