C12H18ClN3O2 — CID 142776771
3-tert-butyl-2-(diaminomethylideneamino)benzoic acid;hydrochloride (PubChem CID 142776771) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 3-tert-butyl-2-(diaminomethylideneamino)benzoic acid;hydrochloride.
| Compound Name | 3-tert-butyl-2-(diaminomethylideneamino)benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 142776771 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-tert-butyl-2-(diaminomethylideneamino)benzoic acid;hydrochloride |
| SMILES | CC(C)(C)c1cccc(C(=O)O)c1N=C(N)N.Cl |
| InChI | InChI=1S/C12H17N3O2.ClH/c1-12(2,3)8-6-4-5-7(10(16)17)9(8)15-11(13)14;/h4-6H,1-3H3,(H,16,17)(H4,13,14,15);1H |
| InChIKey | XNIZDEABTUPHOC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|