C23H34Cl2FN3O2 — CID 175603557
N-[4-[2-[4-(2,3-dichloro-4-fluorophenyl)-3-methylpiperazin-1-yl]ethyl]cyclohexyl]-2-hydroxy-2-methylpropanamide (PubChem CID 175603557) has the molecular formula C23H34Cl2FN3O2 and a molecular weight of 474.45 g/mol. Its IUPAC name is N-[4-[2-[4-(2,3-dichloro-4-fluorophenyl)-3-methylpiperazin-1-yl]ethyl]cyclohexyl]-2-hydroxy-2-methylpropanamide.
| Compound Name | N-[4-[2-[4-(2,3-dichloro-4-fluorophenyl)-3-methylpiperazin-1-yl]ethyl]cyclohexyl]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 175603557 |
| Molecular Formula | C23H34Cl2FN3O2 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[4-[2-[4-(2,3-dichloro-4-fluorophenyl)-3-methylpiperazin-1-yl]ethyl]cyclohexyl]-2-hydroxy-2-methylpropanamide |
| SMILES | CC1CN(CCC2CCC(NC(=O)C(C)(C)O)CC2)CCN1c1ccc(F)c(Cl)c1Cl |
| InChI | InChI=1S/C23H34Cl2FN3O2/c1-15-14-28(12-13-29(15)19-9-8-18(26)20(24)21(19)25)11-10-16-4-6-17(7-5-16)27-22(30)23(2,3)31/h8-9,15-17,31H,4-7,10-14H2,1-3H3,(H,27,30) |
| InChIKey | WSXGDODSUAWBDP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|