C10H17ClN2O2S — CID 175604971
5-methyl-1-(3-methylsulfanylbutan-2-yl)pyrazole-4-carboxylic acid;hydrochloride (PubChem CID 175604971) has the molecular formula C10H17ClN2O2S and a molecular weight of 264.78 g/mol. Its IUPAC name is 5-methyl-1-(3-methylsulfanylbutan-2-yl)pyrazole-4-carboxylic acid;hydrochloride.
| Compound Name | 5-methyl-1-(3-methylsulfanylbutan-2-yl)pyrazole-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 175604971 |
| Molecular Formula | C10H17ClN2O2S |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-methyl-1-(3-methylsulfanylbutan-2-yl)pyrazole-4-carboxylic acid;hydrochloride |
| SMILES | CSC(C)C(C)n1ncc(C(=O)O)c1C.Cl |
| InChI | InChI=1S/C10H16N2O2S.ClH/c1-6(8(3)15-4)12-7(2)9(5-11-12)10(13)14;/h5-6,8H,1-4H3,(H,13,14);1H |
| InChIKey | ZPOICYWIHPIPAG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |