C12H22F2 — CID 175608830
3,4-difluoro-1,2,6-trimethyl-1-propylcyclohexane (PubChem CID 175608830) has the molecular formula C12H22F2 and a molecular weight of 204.30 g/mol. Its IUPAC name is 3,4-difluoro-1,2,6-trimethyl-1-propylcyclohexane.
| Compound Name | 3,4-difluoro-1,2,6-trimethyl-1-propylcyclohexane |
|---|---|
| PubChem CID | 175608830 |
| Molecular Formula | C12H22F2 |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 3,4-difluoro-1,2,6-trimethyl-1-propylcyclohexane |
| SMILES | CCCC1(C)C(C)CC(F)C(F)C1C |
| InChI | InChI=1S/C12H22F2/c1-5-6-12(4)8(2)7-10(13)11(14)9(12)3/h8-11H,5-7H2,1-4H3 |
| InChIKey | POVCVOBJQDOSLI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |