C34H50N4O3S — CID 175609087
(2S,4R)-1-[(2S)-3,3-dimethyl-2-(undec-10-ynylamino)butanoyl]-4-hydroxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 175609087) has the molecular formula C34H50N4O3S and a molecular weight of 594.87 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-3,3-dimethyl-2-(undec-10-ynylamino)butanoyl]-4-hydroxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-3,3-dimethyl-2-(undec-10-ynylamino)butanoyl]-4-hydroxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175609087 |
| Molecular Formula | C34H50N4O3S |
| Molecular Weight | 594.87 g/mol |
| Exact Mass | 594.36 |
| IUPAC Name | (2S,4R)-1-[(2S)-3,3-dimethyl-2-(undec-10-ynylamino)butanoyl]-4-hydroxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | C#CCCCCCCCCCN[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(-c2scnc2C)cc1)C(C)(C)C |
| InChI | InChI=1S/C34H50N4O3S/c1-7-8-9-10-11-12-13-14-15-20-35-31(34(4,5)6)33(41)38-22-28(39)21-29(38)32(40)37-24(2)26-16-18-27(19-17-26)30-25(3)36-23-42-30/h1,16-19,23-24,28-29,31,35,39H,8-15,20-22H2,2-6H3,(H,37,40)/t24-,28+,29-,31+/m0/s1 |
| InChIKey | HGVQULPCZSKGEO-IZJJXFGPSA-N |
| XLogP | 6.02 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.87 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|