C14H11B3BrN5O — CID 175611446
CID 175611446 (PubChem CID 175611446) has the molecular formula C14H11B3BrN5O and a molecular weight of 377.62 g/mol.
| Compound Name | CID 175611446 |
|---|---|
| PubChem CID | 175611446 |
| Molecular Formula | C14H11B3BrN5O |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Nc1nc2nn(-c3c(C)cc(Br)cc3C)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H11B3BrN5O/c1-6-3-8(18)4-7(2)10(6)23-5-9-11(22-23)19-13(20-12(9)24)21-14(15,16)17/h3-5H,1-2H3,(H2,19,20,21,22,24) |
| InChIKey | QQFMPPQLYOEQEE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|