N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride

C4H8ClN3 — CID 175613156

IUPACN'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride
SMILESC/C=C\N/N=C(\N)Cl
InChIInChI=1S/C4H8ClN3/c1-2-3-7-8-4(5)6/h2-3,7H,1H3,(H2,6,8)/b3-2-
InChIKeyCZCJAZPHKNXJJJ-IHWYPQMZSA-N
MW133.58 g/mol
LogP0.58
Rot. Bonds2

About N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride

N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride (PubChem CID 175613156) has the molecular formula C4H8ClN3 and a molecular weight of 133.58 g/mol. Its IUPAC name is N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride.

Molecular Properties

Compound NameN'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride
PubChem CID175613156
Molecular FormulaC4H8ClN3
Molecular Weight133.58 g/mol
Exact Mass133.04
IUPAC NameN'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride
SMILESC/C=C\N/N=C(\N)Cl
InChIInChI=1S/C4H8ClN3/c1-2-3-7-8-4(5)6/h2-3,7H,1H3,(H2,6,8)/b3-2-
InChIKeyCZCJAZPHKNXJJJ-IHWYPQMZSA-N
XLogP0.58
TPSA50.41 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500133.58
LogP ≤ 50.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride?
The IUPAC name of N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride (CID 175613156) is N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride.
What is the SMILES notation for N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride?
The canonical SMILES for N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride is C/C=C\N/N=C(\N)Cl.
What is the InChIKey of N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride?
The InChIKey is CZCJAZPHKNXJJJ-IHWYPQMZSA-N. The full InChI is InChI=1S/C4H8ClN3/c1-2-3-7-8-4(5)6/h2-3,7H,1H3,(H2,6,8)/b3-2-.
What are the key properties of N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride?
N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride has a molecular weight of 133.58 g/mol, XLogP of 0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[(Z)-prop-1-enyl]amino]carbamimidoyl chloride is sourced from PubChem (CID 175613156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).