C10H14N2S — CID 174066266
5-[(2E)-2-[(Z)-pent-3-en-2-ylidene]hydrazinyl]penta-2,4-dienethial (PubChem CID 174066266) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 5-[(2E)-2-[(Z)-pent-3-en-2-ylidene]hydrazinyl]penta-2,4-dienethial.
| Compound Name | 5-[(2E)-2-[(Z)-pent-3-en-2-ylidene]hydrazinyl]penta-2,4-dienethial |
|---|---|
| PubChem CID | 174066266 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-[(2E)-2-[(Z)-pent-3-en-2-ylidene]hydrazinyl]penta-2,4-dienethial |
| SMILES | C/C=C\C(C)=N\NC=CC=CC=S |
| InChI | InChI=1S/C10H14N2S/c1-3-7-10(2)12-11-8-5-4-6-9-13/h3-9,11H,1-2H3/b6-4?,7-3-,8-5?,12-10+ |
| InChIKey | KWFAQRDWXJKWDJ-OOZMDVQKSA-N |
| XLogP | 2.60 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|