C9H9ClF4S — CID 175613699
(3Z,5E)-5-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfanylhepta-1,3,5-triene (PubChem CID 175613699) has the molecular formula C9H9ClF4S and a molecular weight of 260.68 g/mol. Its IUPAC name is (3Z,5E)-5-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfanylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-5-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 175613699 |
| Molecular Formula | C9H9ClF4S |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | (3Z,5E)-5-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfanylhepta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/C)SC(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C9H9ClF4S/c1-3-5-6-7(4-2)15-9(13,14)8(10,11)12/h3-6H,1H2,2H3/b6-5-,7-4+ |
| InChIKey | PWECEZHCMJVUSE-IUQJDUBZSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|