C11H13ClF4S — CID 142240817
(3Z,5E)-2-chloro-5-(3,3,4,4-tetrafluorobutan-2-ylsulfanyl)hepta-1,3,5-triene (PubChem CID 142240817) has the molecular formula C11H13ClF4S and a molecular weight of 288.74 g/mol. Its IUPAC name is (3Z,5E)-2-chloro-5-(3,3,4,4-tetrafluorobutan-2-ylsulfanyl)hepta-1,3,5-triene.
| Compound Name | (3Z,5E)-2-chloro-5-(3,3,4,4-tetrafluorobutan-2-ylsulfanyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 142240817 |
| Molecular Formula | C11H13ClF4S |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (3Z,5E)-2-chloro-5-(3,3,4,4-tetrafluorobutan-2-ylsulfanyl)hepta-1,3,5-triene |
| SMILES | C=C(Cl)/C=C\C(=C/C)SC(C)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H13ClF4S/c1-4-9(6-5-7(2)12)17-8(3)11(15,16)10(13)14/h4-6,8,10H,2H2,1,3H3/b6-5-,9-4+ |
| InChIKey | BVSTWESYTNNLFE-CXBDEZGUSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|