C10H15ClS — CID 123414853
6-chloro-3-propylsulfanylhepta-1,3,5-triene (PubChem CID 123414853) has the molecular formula C10H15ClS and a molecular weight of 202.75 g/mol. Its IUPAC name is 6-chloro-3-propylsulfanylhepta-1,3,5-triene.
| Compound Name | 6-chloro-3-propylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 123414853 |
| Molecular Formula | C10H15ClS |
| Molecular Weight | 202.75 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 6-chloro-3-propylsulfanylhepta-1,3,5-triene |
| SMILES | C=CC(=CC=C(C)Cl)SCCC |
| InChI | InChI=1S/C10H15ClS/c1-4-8-12-10(5-2)7-6-9(3)11/h5-7H,2,4,8H2,1,3H3 |
| InChIKey | PUHFOJOQEVJTML-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|