C10H15ClS2 — CID 134921058
(1E,3E)-1-chloro-1-prop-2-enylsulfanyl-4-propylsulfanylbuta-1,3-diene (PubChem CID 134921058) has the molecular formula C10H15ClS2 and a molecular weight of 234.82 g/mol. Its IUPAC name is (1E,3E)-1-chloro-1-prop-2-enylsulfanyl-4-propylsulfanylbuta-1,3-diene.
| Compound Name | (1E,3E)-1-chloro-1-prop-2-enylsulfanyl-4-propylsulfanylbuta-1,3-diene |
|---|---|
| PubChem CID | 134921058 |
| Molecular Formula | C10H15ClS2 |
| Molecular Weight | 234.82 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (1E,3E)-1-chloro-1-prop-2-enylsulfanyl-4-propylsulfanylbuta-1,3-diene |
| SMILES | C=CCS/C(Cl)=C\C=C\SCCC |
| InChI | InChI=1S/C10H15ClS2/c1-3-7-12-9-5-6-10(11)13-8-4-2/h4-6,9H,2-3,7-8H2,1H3/b9-5+,10-6- |
| InChIKey | XSCOLPVWLVHBRU-POQLCMLLSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|