C8H13ClS — CID 174092975
(3S)-2-[(1Z)-buta-1,3-dienyl]sulfanyl-3-chlorobutane (PubChem CID 174092975) has the molecular formula C8H13ClS and a molecular weight of 176.71 g/mol. Its IUPAC name is (3S)-2-[(1Z)-buta-1,3-dienyl]sulfanyl-3-chlorobutane.
| Compound Name | (3S)-2-[(1Z)-buta-1,3-dienyl]sulfanyl-3-chlorobutane |
|---|---|
| PubChem CID | 174092975 |
| Molecular Formula | C8H13ClS |
| Molecular Weight | 176.71 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | (3S)-2-[(1Z)-buta-1,3-dienyl]sulfanyl-3-chlorobutane |
| SMILES | C=C/C=C\SC(C)[C@H](C)Cl |
| InChI | InChI=1S/C8H13ClS/c1-4-5-6-10-8(3)7(2)9/h4-8H,1H2,2-3H3/b6-5-/t7-,8?/m0/s1 |
| InChIKey | ZXDCYHURVGJOOK-QKNTVEAZSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|