C8H13ClS — CID 134920888
(1E)-1-butylsulfanyl-1-chlorobuta-1,3-diene (PubChem CID 134920888) has the molecular formula C8H13ClS and a molecular weight of 176.71 g/mol. Its IUPAC name is (1E)-1-butylsulfanyl-1-chlorobuta-1,3-diene.
| Compound Name | (1E)-1-butylsulfanyl-1-chlorobuta-1,3-diene |
|---|---|
| PubChem CID | 134920888 |
| Molecular Formula | C8H13ClS |
| Molecular Weight | 176.71 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | (1E)-1-butylsulfanyl-1-chlorobuta-1,3-diene |
| SMILES | C=C/C=C(/Cl)SCCCC |
| InChI | InChI=1S/C8H13ClS/c1-3-5-7-10-8(9)6-4-2/h4,6H,2-3,5,7H2,1H3/b8-6- |
| InChIKey | NBTLHODUSKKPPZ-VURMDHGXSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.71 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|