C6H8Cl2S — CID 134988514
(Z)-1,2-dichloro-1-prop-2-enylsulfanylprop-1-ene (PubChem CID 134988514) has the molecular formula C6H8Cl2S and a molecular weight of 183.10 g/mol. Its IUPAC name is (Z)-1,2-dichloro-1-prop-2-enylsulfanylprop-1-ene.
| Compound Name | (Z)-1,2-dichloro-1-prop-2-enylsulfanylprop-1-ene |
|---|---|
| PubChem CID | 134988514 |
| Molecular Formula | C6H8Cl2S |
| Molecular Weight | 183.10 g/mol |
| Exact Mass | 181.97 |
| IUPAC Name | (Z)-1,2-dichloro-1-prop-2-enylsulfanylprop-1-ene |
| SMILES | C=CCS/C(Cl)=C(\C)Cl |
| InChI | InChI=1S/C6H8Cl2S/c1-3-4-9-6(8)5(2)7/h3H,1,4H2,2H3/b6-5+ |
| InChIKey | SJZZSBVJHCDXQB-AATRIKPKSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|