C11H15ClS2 — CID 143051237
(3Z)-4-[2-[(1E)-1-chlorobuta-1,3-dienyl]sulfanylethylsulfanyl]penta-1,3-diene (PubChem CID 143051237) has the molecular formula C11H15ClS2 and a molecular weight of 246.83 g/mol. Its IUPAC name is (3Z)-4-[2-[(1E)-1-chlorobuta-1,3-dienyl]sulfanylethylsulfanyl]penta-1,3-diene.
| Compound Name | (3Z)-4-[2-[(1E)-1-chlorobuta-1,3-dienyl]sulfanylethylsulfanyl]penta-1,3-diene |
|---|---|
| PubChem CID | 143051237 |
| Molecular Formula | C11H15ClS2 |
| Molecular Weight | 246.83 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (3Z)-4-[2-[(1E)-1-chlorobuta-1,3-dienyl]sulfanylethylsulfanyl]penta-1,3-diene |
| SMILES | C=C/C=C(/C)SCCS/C(Cl)=C\C=C |
| InChI | InChI=1S/C11H15ClS2/c1-4-6-10(3)13-8-9-14-11(12)7-5-2/h4-7H,1-2,8-9H2,3H3/b10-6-,11-7- |
| InChIKey | LUPBOBBYLOLAON-SQXCDDPUSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.83 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|