C10H13ClS — CID 123287151
2-chloro-5-propylsulfanylcyclohepta-1,3,5-triene (PubChem CID 123287151) has the molecular formula C10H13ClS and a molecular weight of 200.73 g/mol. Its IUPAC name is 2-chloro-5-propylsulfanylcyclohepta-1,3,5-triene.
| Compound Name | 2-chloro-5-propylsulfanylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123287151 |
| Molecular Formula | C10H13ClS |
| Molecular Weight | 200.73 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-chloro-5-propylsulfanylcyclohepta-1,3,5-triene |
| SMILES | CCCSC1=CCC=C(Cl)C=C1 |
| InChI | InChI=1S/C10H13ClS/c1-2-8-12-10-5-3-4-9(11)6-7-10/h4-7H,2-3,8H2,1H3 |
| InChIKey | NWUOPBGEHADAKG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |