C11H19ClS — CID 123157638
6-chloro-2-propylsulfanylocta-3,5-diene (PubChem CID 123157638) has the molecular formula C11H19ClS and a molecular weight of 218.79 g/mol. Its IUPAC name is 6-chloro-2-propylsulfanylocta-3,5-diene.
| Compound Name | 6-chloro-2-propylsulfanylocta-3,5-diene |
|---|---|
| PubChem CID | 123157638 |
| Molecular Formula | C11H19ClS |
| Molecular Weight | 218.79 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 6-chloro-2-propylsulfanylocta-3,5-diene |
| SMILES | CCCSC(C)C=CC=C(Cl)CC |
| InChI | InChI=1S/C11H19ClS/c1-4-9-13-10(3)7-6-8-11(12)5-2/h6-8,10H,4-5,9H2,1-3H3 |
| InChIKey | VWGJRZZGQOKLRP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|