C9H13ClS — CID 123864545
1-chloro-4-propylsulfanylcyclohexa-1,3-diene (PubChem CID 123864545) has the molecular formula C9H13ClS and a molecular weight of 188.72 g/mol. Its IUPAC name is 1-chloro-4-propylsulfanylcyclohexa-1,3-diene.
| Compound Name | 1-chloro-4-propylsulfanylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123864545 |
| Molecular Formula | C9H13ClS |
| Molecular Weight | 188.72 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 1-chloro-4-propylsulfanylcyclohexa-1,3-diene |
| SMILES | CCCSC1=CC=C(Cl)CC1 |
| InChI | InChI=1S/C9H13ClS/c1-2-7-11-9-5-3-8(10)4-6-9/h3,5H,2,4,6-7H2,1H3 |
| InChIKey | KDCKRYLQOGJMBA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |