C7H9ClS — CID 123291201
5-chloro-6-methylsulfanylcyclohexa-1,3-diene (PubChem CID 123291201) has the molecular formula C7H9ClS and a molecular weight of 160.67 g/mol. Its IUPAC name is 5-chloro-6-methylsulfanylcyclohexa-1,3-diene.
| Compound Name | 5-chloro-6-methylsulfanylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123291201 |
| Molecular Formula | C7H9ClS |
| Molecular Weight | 160.67 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 5-chloro-6-methylsulfanylcyclohexa-1,3-diene |
| SMILES | CSC1C=CC=CC1Cl |
| InChI | InChI=1S/C7H9ClS/c1-9-7-5-3-2-4-6(7)8/h2-7H,1H3 |
| InChIKey | UJHGESUYXXADLM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|