C11H15ClS — CID 123381872
1-chloro-6-ethylsulfanyl-5-prop-1-enylcyclohexa-1,3-diene (PubChem CID 123381872) has the molecular formula C11H15ClS and a molecular weight of 214.76 g/mol. Its IUPAC name is 1-chloro-6-ethylsulfanyl-5-prop-1-enylcyclohexa-1,3-diene.
| Compound Name | 1-chloro-6-ethylsulfanyl-5-prop-1-enylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123381872 |
| Molecular Formula | C11H15ClS |
| Molecular Weight | 214.76 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 1-chloro-6-ethylsulfanyl-5-prop-1-enylcyclohexa-1,3-diene |
| SMILES | CC=CC1C=CC=C(Cl)C1SCC |
| InChI | InChI=1S/C11H15ClS/c1-3-6-9-7-5-8-10(12)11(9)13-4-2/h3,5-9,11H,4H2,1-2H3 |
| InChIKey | FYOAEKARBAWAQC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|