C10H16S — CID 123417139
5-methyl-2-propylsulfanylcyclohexa-1,3-diene (PubChem CID 123417139) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is 5-methyl-2-propylsulfanylcyclohexa-1,3-diene.
| Compound Name | 5-methyl-2-propylsulfanylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123417139 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 5-methyl-2-propylsulfanylcyclohexa-1,3-diene |
| SMILES | CCCSC1=CCC(C)C=C1 |
| InChI | InChI=1S/C10H16S/c1-3-8-11-10-6-4-9(2)5-7-10/h4,6-7,9H,3,5,8H2,1-2H3 |
| InChIKey | BDJVLWCUYDQMTN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |