C22H24O5 — CID 175617259
2-benzyl-5-(2-benzyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 175617259) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-benzyl-5-(2-benzyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | 2-benzyl-5-(2-benzyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 175617259 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-benzyl-5-(2-benzyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | c1ccc(CC2OCC(C3CC4OC(Cc5ccccc5)OC4O3)O2)cc1 |
| InChI | InChI=1S/C22H24O5/c1-3-7-15(8-4-1)11-20-23-14-19(25-20)17-13-18-22(26-17)27-21(24-18)12-16-9-5-2-6-10-16/h1-10,17-22H,11-14H2 |
| InChIKey | YAOSOCPQSJZUPJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |