C18H28N4O4 — CID 175619070
tert-butyl 4-[N'-[(E)-3-amino-1-ethoxy-1-oxobut-2-en-2-yl]-N-methylidenecarbamimidoyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 175619070) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is tert-butyl 4-[N'-[(E)-3-amino-1-ethoxy-1-oxobut-2-en-2-yl]-N-methylidenecarbamimidoyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[(E)-3-amino-1-ethoxy-1-oxobut-2-en-2-yl]-N-methylidenecarbamimidoyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 175619070 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | tert-butyl 4-[N'-[(E)-3-amino-1-ethoxy-1-oxobut-2-en-2-yl]-N-methylidenecarbamimidoyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=N/C(=N\C(C(=O)OCC)=C(/C)N)C1=CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H28N4O4/c1-7-25-16(23)14(12(2)19)21-15(20-6)13-8-10-22(11-9-13)17(24)26-18(3,4)5/h8H,6-7,9-11,19H2,1-5H3/b14-12+,21-15- |
| InChIKey | CJFORNHSSDPKIS-ZSJLEQRSSA-N |
| XLogP | 2.41 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|