C38H56O4 — CID 175620116
[17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 175620116) has the molecular formula C38H56O4 and a molecular weight of 576.86 g/mol. Its IUPAC name is [17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 175620116 |
| Molecular Formula | C38H56O4 |
| Molecular Weight | 576.86 g/mol |
| Exact Mass | 576.42 |
| IUPAC Name | [17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CCC(CCC(C)C1CCC2C3CC=C4CC(OC(=O)/C=C/c5ccc(O)c(O)c5)CCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C38H56O4/c1-7-27(24(2)3)11-8-25(4)31-14-15-32-30-13-12-28-23-29(18-20-37(28,5)33(30)19-21-38(31,32)6)42-36(41)17-10-26-9-16-34(39)35(40)22-26/h9-10,12,16-17,22,24-25,27,29-33,39-40H,7-8,11,13-15,18-21,23H2,1-6H3/b17-10+ |
| InChIKey | SPMZKLGQGRJQOL-LICLKQGHSA-N |
| XLogP | 9.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.86 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|