C34H60N2O2 — CID 169146283
[(3S,8S,9S,10R,13R,14S)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-amino-2-methylpropyl)carbamate (PubChem CID 169146283) has the molecular formula C34H60N2O2 and a molecular weight of 528.87 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-amino-2-methylpropyl)carbamate.
| Compound Name | [(3S,8S,9S,10R,13R,14S)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-amino-2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 169146283 |
| Molecular Formula | C34H60N2O2 |
| Molecular Weight | 528.87 g/mol |
| Exact Mass | 528.47 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-amino-2-methylpropyl)carbamate |
| SMILES | CCC(CC[C@@H](C)C1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)NCC(C)(C)N)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C34H60N2O2/c1-9-24(22(2)3)11-10-23(4)28-14-15-29-27-13-12-25-20-26(38-31(37)36-21-32(5,6)35)16-18-33(25,7)30(27)17-19-34(28,29)8/h12,22-24,26-30H,9-11,13-21,35H2,1-8H3,(H,36,37)/t23-,24?,26+,27+,28?,29+,30+,33+,34-/m1/s1 |
| InChIKey | ZCLNZBBQENBXSB-OMOUZXRUSA-N |
| XLogP | 8.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.87 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|