C38H62O3 — CID 176948443
[(4E)-cyclooct-4-en-1-yl] [(8S,10R,13R,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate (PubChem CID 176948443) has the molecular formula C38H62O3 and a molecular weight of 566.91 g/mol. Its IUPAC name is [(4E)-cyclooct-4-en-1-yl] [(8S,10R,13R,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate.
| Compound Name | [(4E)-cyclooct-4-en-1-yl] [(8S,10R,13R,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
|---|---|
| PubChem CID | 176948443 |
| Molecular Formula | C38H62O3 |
| Molecular Weight | 566.91 g/mol |
| Exact Mass | 566.47 |
| IUPAC Name | [(4E)-cyclooct-4-en-1-yl] [(8S,10R,13R,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
| SMILES | CC[C@H](CC[C@@H](C)[C@H]1CCC2[C@@H]3CC=C4CC(OC(=O)OC5CC/C=C\CCC5)CC[C@]4(C)C3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C38H62O3/c1-7-28(26(2)3)16-15-27(4)33-19-20-34-32-18-17-29-25-31(21-23-37(29,5)35(32)22-24-38(33,34)6)41-36(39)40-30-13-11-9-8-10-12-14-30/h8-9,17,26-28,30-35H,7,10-16,18-25H2,1-6H3/b9-8-/t27-,28-,30?,31?,32+,33-,34?,35?,37+,38-/m1/s1 |
| InChIKey | BLDGOJOHZQVNSD-XNAVWCHCSA-N |
| XLogP | 11.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.91 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|