C32H55NOS — CID 99571942
O-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(2S,5S)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]] N-ethylcarbamothioate (PubChem CID 99571942) has the molecular formula C32H55NOS and a molecular weight of 501.87 g/mol. Its IUPAC name is O-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(2S,5S)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]] N-ethylcarbamothioate.
| Compound Name | O-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(2S,5S)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]] N-ethylcarbamothioate |
|---|---|
| PubChem CID | 99571942 |
| Molecular Formula | C32H55NOS |
| Molecular Weight | 501.87 g/mol |
| Exact Mass | 501.40 |
| IUPAC Name | O-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(2S,5S)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]] N-ethylcarbamothioate |
| SMILES | CCNC(=S)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@@H](C)CCC(CC)C(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H55NOS/c1-8-23(21(3)4)11-10-22(5)27-14-15-28-26-13-12-24-20-25(34-30(35)33-9-2)16-18-31(24,6)29(26)17-19-32(27,28)7/h12,21-23,25-29H,8-11,13-20H2,1-7H3,(H,33,35)/t22-,23?,25-,26-,27+,28-,29-,31-,32+/m0/s1 |
| InChIKey | YGYTZCGIJHVITR-BXWCCABKSA-N |
| XLogP | 8.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.87 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|