C23H26F2N4O2S — CID 175620564
2,6-difluoro-N-[4-(1-methoxy-2-phenylpropan-2-yl)-1,3-thiazol-2-yl]-4-[2-(methylamino)ethylamino]benzamide (PubChem CID 175620564) has the molecular formula C23H26F2N4O2S and a molecular weight of 460.55 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-(1-methoxy-2-phenylpropan-2-yl)-1,3-thiazol-2-yl]-4-[2-(methylamino)ethylamino]benzamide.
| Compound Name | 2,6-difluoro-N-[4-(1-methoxy-2-phenylpropan-2-yl)-1,3-thiazol-2-yl]-4-[2-(methylamino)ethylamino]benzamide |
|---|---|
| PubChem CID | 175620564 |
| Molecular Formula | C23H26F2N4O2S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2,6-difluoro-N-[4-(1-methoxy-2-phenylpropan-2-yl)-1,3-thiazol-2-yl]-4-[2-(methylamino)ethylamino]benzamide |
| SMILES | CNCCNc1cc(F)c(C(=O)Nc2nc(C(C)(COC)c3ccccc3)cs2)c(F)c1 |
| InChI | InChI=1S/C23H26F2N4O2S/c1-23(14-31-3,15-7-5-4-6-8-15)19-13-32-22(28-19)29-21(30)20-17(24)11-16(12-18(20)25)27-10-9-26-2/h4-8,11-13,26-27H,9-10,14H2,1-3H3,(H,28,29,30) |
| InChIKey | GETJEFALZIGQHE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|