C9H22N2O2S — CID 175620647
2-amino-2-methyl-4-[[methyl(sulfino)amino]methyl]hexane (PubChem CID 175620647) has the molecular formula C9H22N2O2S and a molecular weight of 222.35 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[[methyl(sulfino)amino]methyl]hexane.
| Compound Name | 2-amino-2-methyl-4-[[methyl(sulfino)amino]methyl]hexane |
|---|---|
| PubChem CID | 175620647 |
| Molecular Formula | C9H22N2O2S |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-amino-2-methyl-4-[[methyl(sulfino)amino]methyl]hexane |
| SMILES | CCC(CN(C)S(=O)O)CC(C)(C)N |
| InChI | InChI=1S/C9H22N2O2S/c1-5-8(6-9(2,3)10)7-11(4)14(12)13/h8H,5-7,10H2,1-4H3,(H,12,13) |
| InChIKey | LQHMENRJEXBUOF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|