C9H23N3OS — CID 143141964
N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]-N-methylethanesulfinamide (PubChem CID 143141964) has the molecular formula C9H23N3OS and a molecular weight of 221.37 g/mol. Its IUPAC name is N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]-N-methylethanesulfinamide.
| Compound Name | N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]-N-methylethanesulfinamide |
|---|---|
| PubChem CID | 143141964 |
| Molecular Formula | C9H23N3OS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]-N-methylethanesulfinamide |
| SMILES | CCS(=O)N(C)C[C@@H](NN)C(C)(C)C |
| InChI | InChI=1S/C9H23N3OS/c1-6-14(13)12(5)7-8(11-10)9(2,3)4/h8,11H,6-7,10H2,1-5H3/t8-,14?/m1/s1 |
| InChIKey | YSGYIUPVUIDTIQ-ZSYIFEHUSA-N |
| XLogP | 0.48 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|