C13H24N4O2S — CID 143141951
N-ethyl-N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]pyridine-2-sulfonamide (PubChem CID 143141951) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is N-ethyl-N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]pyridine-2-sulfonamide.
| Compound Name | N-ethyl-N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 143141951 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-ethyl-N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]pyridine-2-sulfonamide |
| SMILES | CCN(C[C@@H](NN)C(C)(C)C)S(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C13H24N4O2S/c1-5-17(10-11(16-14)13(2,3)4)20(18,19)12-8-6-7-9-15-12/h6-9,11,16H,5,10,14H2,1-4H3/t11-/m1/s1 |
| InChIKey | UMJNYNZSVFENAL-LLVKDONJSA-N |
| XLogP | 0.97 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|