C11H11N7 — CID 175621024
2-(methylamino)-4-(pyridazin-3-ylmethylamino)pyrimidine-5-carbonitrile (PubChem CID 175621024) has the molecular formula C11H11N7 and a molecular weight of 241.26 g/mol. Its IUPAC name is 2-(methylamino)-4-(pyridazin-3-ylmethylamino)pyrimidine-5-carbonitrile.
| Compound Name | 2-(methylamino)-4-(pyridazin-3-ylmethylamino)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 175621024 |
| Molecular Formula | C11H11N7 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-(methylamino)-4-(pyridazin-3-ylmethylamino)pyrimidine-5-carbonitrile |
| SMILES | CNc1ncc(C#N)c(NCc2cccnn2)n1 |
| InChI | InChI=1S/C11H11N7/c1-13-11-15-6-8(5-12)10(17-11)14-7-9-3-2-4-16-18-9/h2-4,6H,7H2,1H3,(H2,13,14,15,17) |
| InChIKey | SWVWXFGNLFGILW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |