C17H27F2N2P — CID 175624025
(3Z)-4-(7,7-difluoro-7-phosphanylheptan-3-yl)imino-6-ethyl-3-ethylidenecyclohexa-1,5-dien-1-amine (PubChem CID 175624025) has the molecular formula C17H27F2N2P and a molecular weight of 328.39 g/mol. Its IUPAC name is (3Z)-4-(7,7-difluoro-7-phosphanylheptan-3-yl)imino-6-ethyl-3-ethylidenecyclohexa-1,5-dien-1-amine.
| Compound Name | (3Z)-4-(7,7-difluoro-7-phosphanylheptan-3-yl)imino-6-ethyl-3-ethylidenecyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 175624025 |
| Molecular Formula | C17H27F2N2P |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (3Z)-4-(7,7-difluoro-7-phosphanylheptan-3-yl)imino-6-ethyl-3-ethylidenecyclohexa-1,5-dien-1-amine |
| SMILES | C/C=C1/C=C(N)C(CC)=C/C1=N\C(CC)CCCC(F)(F)P |
| InChI | InChI=1S/C17H27F2N2P/c1-4-12-11-16(13(5-2)10-15(12)20)21-14(6-3)8-7-9-17(18,19)22/h5,10-11,14H,4,6-9,20,22H2,1-3H3/b13-5-,21-16+ |
| InChIKey | DRXMMYKDWLRUQZ-OCGGABOKSA-N |
| XLogP | 4.98 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|