C18H40N2O2 — CID 175628361
1-[5-[3-(dimethylamino)propoxy]-2,5-dimethylhexan-2-yl]oxy-N,N-dimethylpropan-2-amine (PubChem CID 175628361) has the molecular formula C18H40N2O2 and a molecular weight of 316.53 g/mol. Its IUPAC name is 1-[5-[3-(dimethylamino)propoxy]-2,5-dimethylhexan-2-yl]oxy-N,N-dimethylpropan-2-amine.
| Compound Name | 1-[5-[3-(dimethylamino)propoxy]-2,5-dimethylhexan-2-yl]oxy-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 175628361 |
| Molecular Formula | C18H40N2O2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | 1-[5-[3-(dimethylamino)propoxy]-2,5-dimethylhexan-2-yl]oxy-N,N-dimethylpropan-2-amine |
| SMILES | CC(COC(C)(C)CCC(C)(C)OCCCN(C)C)N(C)C |
| InChI | InChI=1S/C18H40N2O2/c1-16(20(8)9)15-22-18(4,5)12-11-17(2,3)21-14-10-13-19(6)7/h16H,10-15H2,1-9H3 |
| InChIKey | LKLWFODZPWXRSI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|