C17H36O — CID 91518034
2-butoxy-5-ethyl-2,5,6-trimethyloctane (PubChem CID 91518034) has the molecular formula C17H36O and a molecular weight of 256.47 g/mol. Its IUPAC name is 2-butoxy-5-ethyl-2,5,6-trimethyloctane.
| Compound Name | 2-butoxy-5-ethyl-2,5,6-trimethyloctane |
|---|---|
| PubChem CID | 91518034 |
| Molecular Formula | C17H36O |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 256.28 |
| IUPAC Name | 2-butoxy-5-ethyl-2,5,6-trimethyloctane |
| SMILES | CCCCOC(C)(C)CCC(C)(CC)C(C)CC |
| InChI | InChI=1S/C17H36O/c1-8-11-14-18-16(5,6)12-13-17(7,10-3)15(4)9-2/h15H,8-14H2,1-7H3 |
| InChIKey | NAGXPHBZLDSWTH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|