C14H30OS — CID 123491559
3-ethyl-2,3-dimethyl-5-(2-methylbutan-2-yloxy)pentane-1-thiol (PubChem CID 123491559) has the molecular formula C14H30OS and a molecular weight of 246.46 g/mol. Its IUPAC name is 3-ethyl-2,3-dimethyl-5-(2-methylbutan-2-yloxy)pentane-1-thiol.
| Compound Name | 3-ethyl-2,3-dimethyl-5-(2-methylbutan-2-yloxy)pentane-1-thiol |
|---|---|
| PubChem CID | 123491559 |
| Molecular Formula | C14H30OS |
| Molecular Weight | 246.46 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 3-ethyl-2,3-dimethyl-5-(2-methylbutan-2-yloxy)pentane-1-thiol |
| SMILES | CCC(C)(C)OCCC(C)(CC)C(C)CS |
| InChI | InChI=1S/C14H30OS/c1-7-13(4,5)15-10-9-14(6,8-2)12(3)11-16/h12,16H,7-11H2,1-6H3 |
| InChIKey | QRNVPXYSDBAGGA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|