C28H58O3 — CID 123287031
5-(3,3-dimethylbutoxy)-3-ethyl-2,3,5-trimethyl-1-[2,3,3-trimethyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyhexane (PubChem CID 123287031) has the molecular formula C28H58O3 and a molecular weight of 442.77 g/mol. Its IUPAC name is 5-(3,3-dimethylbutoxy)-3-ethyl-2,3,5-trimethyl-1-[2,3,3-trimethyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyhexane.
| Compound Name | 5-(3,3-dimethylbutoxy)-3-ethyl-2,3,5-trimethyl-1-[2,3,3-trimethyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyhexane |
|---|---|
| PubChem CID | 123287031 |
| Molecular Formula | C28H58O3 |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.44 |
| IUPAC Name | 5-(3,3-dimethylbutoxy)-3-ethyl-2,3,5-trimethyl-1-[2,3,3-trimethyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyhexane |
| SMILES | CCC(C)(CC(C)(C)OCCC(C)(C)C)C(C)COC(C)(C)C(C)(C)COC(C)(C)C |
| InChI | InChI=1S/C28H58O3/c1-16-28(15,20-26(11,12)29-18-17-23(3,4)5)22(2)19-30-27(13,14)25(9,10)21-31-24(6,7)8/h22H,16-21H2,1-15H3 |
| InChIKey | VRJTTYGDEGNSBT-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |