C28H60N2O3 — CID 175624779
4-[5-[5-(3-amino-2-methylbutan-2-yl)oxy-2,3,3,4-tetramethylpentan-2-yl]oxy-2,3,3-trimethylpentan-2-yl]oxy-2,3-dimethylbutan-2-amine (PubChem CID 175624779) has the molecular formula C28H60N2O3 and a molecular weight of 472.80 g/mol. Its IUPAC name is 4-[5-[5-(3-amino-2-methylbutan-2-yl)oxy-2,3,3,4-tetramethylpentan-2-yl]oxy-2,3,3-trimethylpentan-2-yl]oxy-2,3-dimethylbutan-2-amine.
| Compound Name | 4-[5-[5-(3-amino-2-methylbutan-2-yl)oxy-2,3,3,4-tetramethylpentan-2-yl]oxy-2,3,3-trimethylpentan-2-yl]oxy-2,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 175624779 |
| Molecular Formula | C28H60N2O3 |
| Molecular Weight | 472.80 g/mol |
| Exact Mass | 472.46 |
| IUPAC Name | 4-[5-[5-(3-amino-2-methylbutan-2-yl)oxy-2,3,3,4-tetramethylpentan-2-yl]oxy-2,3,3-trimethylpentan-2-yl]oxy-2,3-dimethylbutan-2-amine |
| SMILES | CC(COC(C)(C)C(C)(C)CCOC(C)(C)C(C)(C)C(C)COC(C)(C)C(C)N)C(C)(C)N |
| InChI | InChI=1S/C28H60N2O3/c1-20(18-32-26(10,11)22(3)29)24(6,7)28(14,15)31-17-16-23(4,5)27(12,13)33-19-21(2)25(8,9)30/h20-22H,16-19,29-30H2,1-15H3 |
| InChIKey | VTPIANIWBOPQLT-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.80 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |