C11H26N2OS — CID 130217524
4-amino-2-(3-amino-2,3-dimethylbutoxy)-3-methylbutane-2-thiol (PubChem CID 130217524) has the molecular formula C11H26N2OS and a molecular weight of 234.41 g/mol. Its IUPAC name is 4-amino-2-(3-amino-2,3-dimethylbutoxy)-3-methylbutane-2-thiol.
| Compound Name | 4-amino-2-(3-amino-2,3-dimethylbutoxy)-3-methylbutane-2-thiol |
|---|---|
| PubChem CID | 130217524 |
| Molecular Formula | C11H26N2OS |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 4-amino-2-(3-amino-2,3-dimethylbutoxy)-3-methylbutane-2-thiol |
| SMILES | CC(COC(C)(S)C(C)CN)C(C)(C)N |
| InChI | InChI=1S/C11H26N2OS/c1-8(6-12)11(5,15)14-7-9(2)10(3,4)13/h8-9,15H,6-7,12-13H2,1-5H3 |
| InChIKey | CAUIQJIQBGXWHS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|