C37H73F3N2O4 — CID 129140644
N-[4-[4-[4-(3-amino-2,3-dimethylbutoxy)-3,3,4-trimethylpentoxy]-2,3,3,4-tetramethylpentoxy]-4-methylpentan-2-yl]-3,3,4-trifluoro-2,2,4-trimethylpentanamide (PubChem CID 129140644) has the molecular formula C37H73F3N2O4 and a molecular weight of 667.00 g/mol. Its IUPAC name is N-[4-[4-[4-(3-amino-2,3-dimethylbutoxy)-3,3,4-trimethylpentoxy]-2,3,3,4-tetramethylpentoxy]-4-methylpentan-2-yl]-3,3,4-trifluoro-2,2,4-trimethylpentanamide.
| Compound Name | N-[4-[4-[4-(3-amino-2,3-dimethylbutoxy)-3,3,4-trimethylpentoxy]-2,3,3,4-tetramethylpentoxy]-4-methylpentan-2-yl]-3,3,4-trifluoro-2,2,4-trimethylpentanamide |
|---|---|
| PubChem CID | 129140644 |
| Molecular Formula | C37H73F3N2O4 |
| Molecular Weight | 667.00 g/mol |
| Exact Mass | 666.55 |
| IUPAC Name | N-[4-[4-[4-(3-amino-2,3-dimethylbutoxy)-3,3,4-trimethylpentoxy]-2,3,3,4-tetramethylpentoxy]-4-methylpentan-2-yl]-3,3,4-trifluoro-2,2,4-trimethylpentanamide |
| SMILES | CC(CC(C)(C)OCC(C)C(C)(C)C(C)(C)OCCC(C)(C)C(C)(C)OCC(C)C(C)(C)N)NC(=O)C(C)(C)C(F)(F)C(C)(C)F |
| InChI | InChI=1S/C37H73F3N2O4/c1-25(23-45-30(6,7)22-27(3)42-28(43)32(10,11)37(39,40)34(14,15)38)31(8,9)36(18,19)44-21-20-29(4,5)35(16,17)46-24-26(2)33(12,13)41/h25-27H,20-24,41H2,1-19H3,(H,42,43) |
| InChIKey | NIIZHFRYQSCGHV-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.00 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |