C25H48N2O5 — CID 88941520
2-[[2,3-dimethyl-4-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]pentan-2-yl]oxybutan-2-yl]carbamoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 88941520) has the molecular formula C25H48N2O5 and a molecular weight of 456.67 g/mol. Its IUPAC name is 2-[[2,3-dimethyl-4-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]pentan-2-yl]oxybutan-2-yl]carbamoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2,3-dimethyl-4-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]pentan-2-yl]oxybutan-2-yl]carbamoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88941520 |
| Molecular Formula | C25H48N2O5 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 2-[[2,3-dimethyl-4-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]pentan-2-yl]oxybutan-2-yl]carbamoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)NC(C)(C)C(C)COC(C)(C)C(C)(C)CCOC(C)(C)C |
| InChI | InChI=1S/C25H48N2O5/c1-18(2)20(28)30-16-14-26-21(29)27-24(9,10)19(3)17-32-25(11,12)23(7,8)13-15-31-22(4,5)6/h19H,1,13-17H2,2-12H3,(H2,26,27,29) |
| InChIKey | SXQDTHPBHBBCAV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|