C15H25ClN2O5 — CID 20643869
(1-chloro-2-methylpropan-2-yl) 2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]propanoate (PubChem CID 20643869) has the molecular formula C15H25ClN2O5 and a molecular weight of 348.83 g/mol. Its IUPAC name is (1-chloro-2-methylpropan-2-yl) 2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]propanoate.
| Compound Name | (1-chloro-2-methylpropan-2-yl) 2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]propanoate |
|---|---|
| PubChem CID | 20643869 |
| Molecular Formula | C15H25ClN2O5 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (1-chloro-2-methylpropan-2-yl) 2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]propanoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)NCC(C)C(=O)OC(C)(C)CCl |
| InChI | InChI=1S/C15H25ClN2O5/c1-10(2)12(19)22-7-6-17-14(21)18-8-11(3)13(20)23-15(4,5)9-16/h11H,1,6-9H2,2-5H3,(H2,17,18,21) |
| InChIKey | SKRUZOYCPSUELV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|