C18H31N3O7 — CID 87085903
2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]hexanoic acid (PubChem CID 87085903) has the molecular formula C18H31N3O7 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]hexanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 87085903 |
| Molecular Formula | C18H31N3O7 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]hexanoic acid |
| SMILES | C=C(C)C(=O)OCCNC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C18H31N3O7/c1-12(2)15(24)27-11-10-20-16(25)19-9-7-6-8-13(14(22)23)21-17(26)28-18(3,4)5/h13H,1,6-11H2,2-5H3,(H,21,26)(H,22,23)(H2,19,20,25) |
| InChIKey | OKWXHWRTHHRYCD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|