C28H60N2O3 — CID 89130713
4-[4-[4-(3-amino-2,3-dimethylbutoxy)-3,3,4-trimethylpentoxy]-2,3,3-trimethylpentoxy]-4-methylpentan-2-amine (PubChem CID 89130713) has the molecular formula C28H60N2O3 and a molecular weight of 472.80 g/mol. Its IUPAC name is 4-[4-[4-(3-amino-2,3-dimethylbutoxy)-3,3,4-trimethylpentoxy]-2,3,3-trimethylpentoxy]-4-methylpentan-2-amine.
| Compound Name | 4-[4-[4-(3-amino-2,3-dimethylbutoxy)-3,3,4-trimethylpentoxy]-2,3,3-trimethylpentoxy]-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 89130713 |
| Molecular Formula | C28H60N2O3 |
| Molecular Weight | 472.80 g/mol |
| Exact Mass | 472.46 |
| IUPAC Name | 4-[4-[4-(3-amino-2,3-dimethylbutoxy)-3,3,4-trimethylpentoxy]-2,3,3-trimethylpentoxy]-4-methylpentan-2-amine |
| SMILES | CC(N)CC(C)(C)OCC(C)C(C)(C)C(C)OCCC(C)(C)C(C)(C)OCC(C)C(C)(C)N |
| InChI | InChI=1S/C28H60N2O3/c1-20(18-32-25(7,8)17-22(3)29)26(9,10)23(4)31-16-15-24(5,6)28(13,14)33-19-21(2)27(11,12)30/h20-23H,15-19,29-30H2,1-14H3 |
| InChIKey | PWNKIJYQXKFONA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.80 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |