C15H31ClO — CID 129235244
(2R)-1-chloro-3-ethyl-2,3,5-trimethyl-5-[(2-methylpropan-2-yl)oxy]hexane (PubChem CID 129235244) has the molecular formula C15H31ClO and a molecular weight of 262.86 g/mol. Its IUPAC name is (2R)-1-chloro-3-ethyl-2,3,5-trimethyl-5-[(2-methylpropan-2-yl)oxy]hexane.
| Compound Name | (2R)-1-chloro-3-ethyl-2,3,5-trimethyl-5-[(2-methylpropan-2-yl)oxy]hexane |
|---|---|
| PubChem CID | 129235244 |
| Molecular Formula | C15H31ClO |
| Molecular Weight | 262.86 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | (2R)-1-chloro-3-ethyl-2,3,5-trimethyl-5-[(2-methylpropan-2-yl)oxy]hexane |
| SMILES | CCC(C)(CC(C)(C)OC(C)(C)C)[C@@H](C)CCl |
| InChI | InChI=1S/C15H31ClO/c1-9-15(8,12(2)10-16)11-14(6,7)17-13(3,4)5/h12H,9-11H2,1-8H3/t12-,15?/m0/s1 |
| InChIKey | LJEKJQMBXZMPSW-SFVWDYPZSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.86 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|