C13H27BrO — CID 129235269
1-bromo-3,3,5-trimethyl-5-[(2-methylpropan-2-yl)oxy]hexane (PubChem CID 129235269) has the molecular formula C13H27BrO and a molecular weight of 279.26 g/mol. Its IUPAC name is 1-bromo-3,3,5-trimethyl-5-[(2-methylpropan-2-yl)oxy]hexane.
| Compound Name | 1-bromo-3,3,5-trimethyl-5-[(2-methylpropan-2-yl)oxy]hexane |
|---|---|
| PubChem CID | 129235269 |
| Molecular Formula | C13H27BrO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-bromo-3,3,5-trimethyl-5-[(2-methylpropan-2-yl)oxy]hexane |
| SMILES | CC(C)(CCBr)CC(C)(C)OC(C)(C)C |
| InChI | InChI=1S/C13H27BrO/c1-11(2,3)15-13(6,7)10-12(4,5)8-9-14/h8-10H2,1-7H3 |
| InChIKey | YHRWSBPMIGBWQK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|