C30H64N2O2 — CID 144805334
6-[6-(5-amino-2,4,4-trimethylpentan-2-yl)oxy-2,4,4,6-tetramethylheptan-2-yl]oxy-2,4,4,6-tetramethylheptan-2-amine (PubChem CID 144805334) has the molecular formula C30H64N2O2 and a molecular weight of 484.85 g/mol. Its IUPAC name is 6-[6-(5-amino-2,4,4-trimethylpentan-2-yl)oxy-2,4,4,6-tetramethylheptan-2-yl]oxy-2,4,4,6-tetramethylheptan-2-amine.
| Compound Name | 6-[6-(5-amino-2,4,4-trimethylpentan-2-yl)oxy-2,4,4,6-tetramethylheptan-2-yl]oxy-2,4,4,6-tetramethylheptan-2-amine |
|---|---|
| PubChem CID | 144805334 |
| Molecular Formula | C30H64N2O2 |
| Molecular Weight | 484.85 g/mol |
| Exact Mass | 484.50 |
| IUPAC Name | 6-[6-(5-amino-2,4,4-trimethylpentan-2-yl)oxy-2,4,4,6-tetramethylheptan-2-yl]oxy-2,4,4,6-tetramethylheptan-2-amine |
| SMILES | CC(C)(N)CC(C)(C)CC(C)(C)OC(C)(C)CC(C)(C)CC(C)(C)OC(C)(C)CC(C)(C)CN |
| InChI | InChI=1S/C30H64N2O2/c1-23(2,17-26(7,8)32)18-27(9,10)33-28(11,12)19-24(3,4)20-29(13,14)34-30(15,16)21-25(5,6)22-31/h17-22,31-32H2,1-16H3 |
| InChIKey | HFWMEVDCXXNSRW-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.85 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |